C13H15F5N2 — CID 91322362
N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]piperidin-4-amine (PubChem CID 91322362) has the molecular formula C13H15F5N2 and a molecular weight of 294.27 g/mol. Its IUPAC name is N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]piperidin-4-amine.
| Compound Name | N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 91322362 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]piperidin-4-amine |
| SMILES | FC(F)(F)C(F)(F)c1cccc(NC2CCNCC2)c1 |
| InChI | InChI=1S/C13H15F5N2/c14-12(15,13(16,17)18)9-2-1-3-11(8-9)20-10-4-6-19-7-5-10/h1-3,8,10,19-20H,4-7H2 |
| InChIKey | ULXKLSZHTFCZJS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|