C32H31BrN4O6S2 — CID 91322538
tert-butyl N-[2-[[5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-4-bromothiophene-2-carbonyl]-hydroxyamino]-3-phenylpropyl]carbamate (PubChem CID 91322538) has the molecular formula C32H31BrN4O6S2 and a molecular weight of 711.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-4-bromothiophene-2-carbonyl]-hydroxyamino]-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-4-bromothiophene-2-carbonyl]-hydroxyamino]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 91322538 |
| Molecular Formula | C32H31BrN4O6S2 |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 710.09 |
| IUPAC Name | tert-butyl N-[2-[[5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-4-bromothiophene-2-carbonyl]-hydroxyamino]-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(Cc1ccccc1)N(O)C(=O)c1cc(Br)c(-c2ccnc3c2ccn3S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C32H31BrN4O6S2/c1-32(2,3)43-31(39)35-20-22(18-21-10-6-4-7-11-21)37(40)30(38)27-19-26(33)28(44-27)24-14-16-34-29-25(24)15-17-36(29)45(41,42)23-12-8-5-9-13-23/h4-17,19,22,40H,18,20H2,1-3H3,(H,35,39) |
| InChIKey | TZRSGYUMMIMNPL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|