C26H28F3N7O2 — CID 91322642
ethanimidoyl 2-[4-[2-[4-(4-cyano-1-methylimidazo[4,5-c]pyridin-6-yl)-2-(trifluoromethyl)phenoxy]ethyl]piperidin-1-yl]ethanimidate (PubChem CID 91322642) has the molecular formula C26H28F3N7O2 and a molecular weight of 527.55 g/mol. Its IUPAC name is ethanimidoyl 2-[4-[2-[4-(4-cyano-1-methylimidazo[4,5-c]pyridin-6-yl)-2-(trifluoromethyl)phenoxy]ethyl]piperidin-1-yl]ethanimidate.
| Compound Name | ethanimidoyl 2-[4-[2-[4-(4-cyano-1-methylimidazo[4,5-c]pyridin-6-yl)-2-(trifluoromethyl)phenoxy]ethyl]piperidin-1-yl]ethanimidate |
|---|---|
| PubChem CID | 91322642 |
| Molecular Formula | C26H28F3N7O2 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethanimidoyl 2-[4-[2-[4-(4-cyano-1-methylimidazo[4,5-c]pyridin-6-yl)-2-(trifluoromethyl)phenoxy]ethyl]piperidin-1-yl]ethanimidate |
| SMILES | [H]/N=C(/CN1CCC(CCOc2ccc(-c3cc4c(ncn4C)c(C#N)n3)cc2C(F)(F)F)CC1)O/C(C)=N/[H] |
| InChI | InChI=1S/C26H28F3N7O2/c1-16(31)38-24(32)14-36-8-5-17(6-9-36)7-10-37-23-4-3-18(11-19(23)26(27,28)29)20-12-22-25(21(13-30)34-20)33-15-35(22)2/h3-4,11-12,15,17,31-32H,5-10,14H2,1-2H3/b31-16+,32-24- |
| InChIKey | DLZLQGDCBWBZPA-MGCRZHQESA-N |
| XLogP | 5.00 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|