C28H32Cl2N2O4 — CID 91322887
tert-butyl (1S,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(5-chloro-2-pyridinyl)-3a-ethyl-1-methyl-3-oxo-1,6,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 91322887) has the molecular formula C28H32Cl2N2O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is tert-butyl (1S,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(5-chloro-2-pyridinyl)-3a-ethyl-1-methyl-3-oxo-1,6,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (1S,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(5-chloro-2-pyridinyl)-3a-ethyl-1-methyl-3-oxo-1,6,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 91322887 |
| Molecular Formula | C28H32Cl2N2O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | tert-butyl (1S,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(5-chloro-2-pyridinyl)-3a-ethyl-1-methyl-3-oxo-1,6,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CC[C@@]12C=C[C@@H](c3ccc(OC)cc3Cl)[C@H](c3ccc(Cl)cn3)[C@@H]1[C@H](C)N(C(=O)OC(C)(C)C)C2=O |
| InChI | InChI=1S/C28H32Cl2N2O4/c1-7-28-13-12-20(19-10-9-18(35-6)14-21(19)30)23(22-11-8-17(29)15-31-22)24(28)16(2)32(25(28)33)26(34)36-27(3,4)5/h8-16,20,23-24H,7H2,1-6H3/t16-,20-,23+,24-,28+/m0/s1 |
| InChIKey | DHIFQMQYSSFAMS-RGTLVKNBSA-N |
| XLogP | 7.01 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|