C14H13ClF2N2OS — CID 91322921
4-[4-[(3-chloro-2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]morpholine (PubChem CID 91322921) has the molecular formula C14H13ClF2N2OS and a molecular weight of 330.79 g/mol. Its IUPAC name is 4-[4-[(3-chloro-2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-[(3-chloro-2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 91322921 |
| Molecular Formula | C14H13ClF2N2OS |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-[4-[(3-chloro-2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]morpholine |
| SMILES | Fc1ccc(Cc2csc(N3CCOCC3)n2)c(F)c1Cl |
| InChI | InChI=1S/C14H13ClF2N2OS/c15-12-11(16)2-1-9(13(12)17)7-10-8-21-14(18-10)19-3-5-20-6-4-19/h1-2,8H,3-7H2 |
| InChIKey | GGBFJCGPSNNLQY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|