C13H29NS — CID 91322949
N,N-diethyl-2-(methylsulfanylmethyl)heptan-1-amine (PubChem CID 91322949) has the molecular formula C13H29NS and a molecular weight of 231.45 g/mol. Its IUPAC name is N,N-diethyl-2-(methylsulfanylmethyl)heptan-1-amine.
| Compound Name | N,N-diethyl-2-(methylsulfanylmethyl)heptan-1-amine |
|---|---|
| PubChem CID | 91322949 |
| Molecular Formula | C13H29NS |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N,N-diethyl-2-(methylsulfanylmethyl)heptan-1-amine |
| SMILES | CCCCCC(CSC)CN(CC)CC |
| InChI | InChI=1S/C13H29NS/c1-5-8-9-10-13(12-15-4)11-14(6-2)7-3/h13H,5-12H2,1-4H3 |
| InChIKey | SSSIVNVGMWGMQW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|