C19H38NO6+ — CID 91323271
2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium;methyl propanoate (PubChem CID 91323271) has the molecular formula C19H38NO6+ and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium;methyl propanoate.
| Compound Name | 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium;methyl propanoate |
|---|---|
| PubChem CID | 91323271 |
| Molecular Formula | C19H38NO6+ |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium;methyl propanoate |
| SMILES | CCC(=O)OC.COC(=O)C(C)(C)CC(C)(C)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C15H30NO4.C4H8O2/c1-14(2,12(17)19-8)11-15(3,4)13(18)20-10-9-16(5,6)7;1-3-4(5)6-2/h9-11H2,1-8H3;3H2,1-2H3/q+1; |
| InChIKey | QEGXFNWUJSVNBQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|