C49H76 — CID 91323592
3-[1-(6-tert-butyl-2,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-1-phenylpent-4-enyl]-10-methyl-10-[1-(1-methylcyclooctyl)ethyl]spiro[4.6]undecane (PubChem CID 91323592) has the molecular formula C49H76 and a molecular weight of 665.15 g/mol. Its IUPAC name is 3-[1-(6-tert-butyl-2,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-1-phenylpent-4-enyl]-10-methyl-10-[1-(1-methylcyclooctyl)ethyl]spiro[4.6]undecane.
| Compound Name | 3-[1-(6-tert-butyl-2,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-1-phenylpent-4-enyl]-10-methyl-10-[1-(1-methylcyclooctyl)ethyl]spiro[4.6]undecane |
|---|---|
| PubChem CID | 91323592 |
| Molecular Formula | C49H76 |
| Molecular Weight | 665.15 g/mol |
| Exact Mass | 664.59 |
| IUPAC Name | 3-[1-(6-tert-butyl-2,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-1-phenylpent-4-enyl]-10-methyl-10-[1-(1-methylcyclooctyl)ethyl]spiro[4.6]undecane |
| SMILES | C=CCCC(c1ccccc1)(C1CCC2(CCCCC(C)(C(C)C3(C)CCCCCCC3)C2)C1)C1C(C)C(C)C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C49H76/c1-10-11-31-49(39-22-16-15-17-23-39,44-37(3)36(2)42-25-24-40(33-43(42)44)45(5,6)7)41-26-32-48(34-41)30-21-20-29-47(9,35-48)38(4)46(8)27-18-13-12-14-19-28-46/h10,15-17,22-25,33,36-38,41-44H,1,11-14,18-21,26-32,34-35H2,2-9H3 |
| InChIKey | OCGSPVFLPIFHAW-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.15 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|