About 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane
5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane (PubChem CID 91323625) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane.
Molecular Properties
| Compound Name | 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane |
| PubChem CID | 91323625 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane |
| SMILES | CC.CC1=C(C)OCCO1 |
| InChI | InChI=1S/C6H10O2.C2H6/c1-5-6(2)8-4-3-7-5;1-2/h3-4H2,1-2H3;1-2H3 |
| InChIKey | GLWQIKJMCKGOEZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane?
The IUPAC name of 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane (CID 91323625) is 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane.
What is the SMILES notation for 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane?
The canonical SMILES for 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane is CC.CC1=C(C)OCCO1.
What is the InChIKey of 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane?
The InChIKey is GLWQIKJMCKGOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H6/c1-5-6(2)8-4-3-7-5;1-2/h3-4H2,1-2H3;1-2H3.
What are the key properties of 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane?
5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane has a molecular weight of 144.21 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane is sourced from PubChem (CID 91323625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).