C17H21N5O7 — CID 91323662
5-hydroxy-1-(1,2,4-oxadiazol-3-ylmethyl)-4,6-dioxo-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxylic acid (PubChem CID 91323662) has the molecular formula C17H21N5O7 and a molecular weight of 407.38 g/mol. Its IUPAC name is 5-hydroxy-1-(1,2,4-oxadiazol-3-ylmethyl)-4,6-dioxo-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxylic acid.
| Compound Name | 5-hydroxy-1-(1,2,4-oxadiazol-3-ylmethyl)-4,6-dioxo-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxylic acid |
|---|---|
| PubChem CID | 91323662 |
| Molecular Formula | C17H21N5O7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 5-hydroxy-1-(1,2,4-oxadiazol-3-ylmethyl)-4,6-dioxo-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxylic acid |
| SMILES | CC(C)OCCCN1CN(Cc2ncon2)n2cc(C(=O)O)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C17H21N5O7/c1-10(2)28-5-3-4-20-9-21(7-12-18-8-29-19-12)22-6-11(17(26)27)14(23)15(24)13(22)16(20)25/h6,8,10,24H,3-5,7,9H2,1-2H3,(H,26,27) |
| InChIKey | WFFGGNCJBSJVNF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|