C25H30F2N2O2 — CID 91323741
1-[(1R,3R)-3-[bis(4-fluorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine (PubChem CID 91323741) has the molecular formula C25H30F2N2O2 and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[bis(4-fluorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine.
| Compound Name | 1-[(1R,3R)-3-[bis(4-fluorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
|---|---|
| PubChem CID | 91323741 |
| Molecular Formula | C25H30F2N2O2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[(1R,3R)-3-[bis(4-fluorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
| SMILES | CCC(NOC)=C1[C@H]2CCC(C[C@H]1OC(c1ccc(F)cc1)c1ccc(F)cc1)N2C |
| InChI | InChI=1S/C25H30F2N2O2/c1-4-21(28-30-3)24-22-14-13-20(29(22)2)15-23(24)31-25(16-5-9-18(26)10-6-16)17-7-11-19(27)12-8-17/h5-12,20,22-23,25,28H,4,13-15H2,1-3H3/t20?,22-,23-/m1/s1 |
| InChIKey | CXUFJCQUFJCKSK-JHRSTNGLSA-N |
| XLogP | 5.12 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|