C23H33N5O4 — CID 91323842
5-[[4-amino-6-(3-tert-butyl-2,4,4-trimethylpentyl)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 91323842) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5-[[4-amino-6-(3-tert-butyl-2,4,4-trimethylpentyl)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-amino-6-(3-tert-butyl-2,4,4-trimethylpentyl)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91323842 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 5-[[4-amino-6-(3-tert-butyl-2,4,4-trimethylpentyl)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | CC(Cc1nc(N)nc(Nc2cc(C(=O)O)cc(C(=O)O)c2)n1)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H33N5O4/c1-12(17(22(2,3)4)23(5,6)7)8-16-26-20(24)28-21(27-16)25-15-10-13(18(29)30)9-14(11-15)19(31)32/h9-12,17H,8H2,1-7H3,(H,29,30)(H,31,32)(H3,24,25,26,27,28) |
| InChIKey | WHMXJIFCAQQART-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |