About N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide
N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide (PubChem CID 91324094) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide |
| PubChem CID | 91324094 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide |
| SMILES | CC(=O)NC(C(=O)NN)C(C)(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-5(12)10-6(7(13)11-9)8(2,3)4/h6H,9H2,1-4H3,(H,10,12)(H,11,13) |
| InChIKey | NHILRZZDWAWXSJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide?
The IUPAC name of N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide (CID 91324094) is N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide.
What is the SMILES notation for N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide?
The canonical SMILES for N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide is CC(=O)NC(C(=O)NN)C(C)(C)C.
What is the InChIKey of N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide?
The InChIKey is NHILRZZDWAWXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-5(12)10-6(7(13)11-9)8(2,3)4/h6H,9H2,1-4H3,(H,10,12)(H,11,13).
What are the key properties of N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide?
N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide has a molecular weight of 187.24 g/mol, XLogP of -0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydrazinyl-3,3-dimethyl-1-oxobutan-2-yl)acetamide is sourced from PubChem (CID 91324094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).