C22H25N3O5S — CID 91324417
[6-(3-cyanobutyl)-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 91324417) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is [6-(3-cyanobutyl)-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-(3-cyanobutyl)-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91324417 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [6-(3-cyanobutyl)-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C#N)CCc1ccc2cc(OC(=O)C(C)(C)C)c(N3C=C(O)NS3(=O)=O)cc2c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-14(12-23)5-6-15-7-8-16-11-19(30-21(27)22(2,3)4)18(10-17(16)9-15)25-13-20(26)24-31(25,28)29/h7-11,13-14,24,26H,5-6H2,1-4H3 |
| InChIKey | POKFFWKUBXETEQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|