About 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine
3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine (PubChem CID 91324538) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine.
Molecular Properties
| Compound Name | 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine |
| PubChem CID | 91324538 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine |
| SMILES | C=C1C=C(CC)CC(CC)C(N)=N1 |
| InChI | InChI=1S/C11H18N2/c1-4-9-6-8(3)13-11(12)10(5-2)7-9/h6,10H,3-5,7H2,1-2H3,(H2,12,13) |
| InChIKey | OYEGYVUVRUEVFX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The IUPAC name of 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine (CID 91324538) is 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine.
What is the SMILES notation for 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The canonical SMILES for 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine is C=C1C=C(CC)CC(CC)C(N)=N1.
What is the InChIKey of 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine?
The InChIKey is OYEGYVUVRUEVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-9-6-8(3)13-11(12)10(5-2)7-9/h6,10H,3-5,7H2,1-2H3,(H2,12,13).
What are the key properties of 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine?
3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine has a molecular weight of 178.28 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-7-methylidene-3,4-dihydroazepin-2-amine is sourced from PubChem (CID 91324538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).