About 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol
4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol (PubChem CID 91325340) has the molecular formula C27H22N6OS2
and a molecular weight of 510.65 g/mol. Its IUPAC name is 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol.
Molecular Properties
| Compound Name | 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol |
| PubChem CID | 91325340 |
| Molecular Formula | C27H22N6OS2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol |
| SMILES | Cc1cc(CSc2nccc(-c3cccnc3)n2)c(O)c(CSc2nccc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C27H22N6OS2/c1-18-12-21(16-35-26-30-10-6-23(32-26)19-4-2-8-28-14-19)25(34)22(13-18)17-36-27-31-11-7-24(33-27)20-5-3-9-29-15-20/h2-15,34H,16-17H2,1H3 |
| InChIKey | YTIMPCHGQNHWNG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol?
The IUPAC name of 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol (CID 91325340) is 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol.
What is the SMILES notation for 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol?
The canonical SMILES for 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol is Cc1cc(CSc2nccc(-c3cccnc3)n2)c(O)c(CSc2nccc(-c3cccnc3)n2)c1.
What is the InChIKey of 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol?
The InChIKey is YTIMPCHGQNHWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N6OS2/c1-18-12-21(16-35-26-30-10-6-23(32-26)19-4-2-8-28-14-19)25(34)22(13-18)17-36-27-31-11-7-24(33-27)20-5-3-9-29-15-20/h2-15,34H,16-17H2,1H3.
What are the key properties of 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol?
4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol has a molecular weight of 510.65 g/mol, XLogP of 5.99, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-bis[(4-pyridin-3-ylpyrimidin-2-yl)sulfanylmethyl]phenol is sourced from PubChem (CID 91325340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).