C6H9N3 — CID 91325798
5-but-2-en-2-yl-1H-1,2,4-triazole (PubChem CID 91325798) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 5-but-2-en-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-but-2-en-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 91325798 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5-but-2-en-2-yl-1H-1,2,4-triazole |
| SMILES | CC=C(C)c1ncn[nH]1 |
| InChI | InChI=1S/C6H9N3/c1-3-5(2)6-7-4-8-9-6/h3-4H,1-2H3,(H,7,8,9) |
| InChIKey | SJLHYRHAKLBNJV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |