C30H54 — CID 91326034
1,2,3,3,4,4,5,6,6,7,8,8,9,10,10,11,11,12-octadecamethyltetracyclo[5.5.0.02,5.09,12]dodecane (PubChem CID 91326034) has the molecular formula C30H54 and a molecular weight of 414.76 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,6,6,7,8,8,9,10,10,11,11,12-octadecamethyltetracyclo[5.5.0.02,5.09,12]dodecane.
| Compound Name | 1,2,3,3,4,4,5,6,6,7,8,8,9,10,10,11,11,12-octadecamethyltetracyclo[5.5.0.02,5.09,12]dodecane |
|---|---|
| PubChem CID | 91326034 |
| Molecular Formula | C30H54 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | 1,2,3,3,4,4,5,6,6,7,8,8,9,10,10,11,11,12-octadecamethyltetracyclo[5.5.0.02,5.09,12]dodecane |
| SMILES | CC1(C)C(C)(C)C2(C)C1(C)C(C)(C)C1(C)C(C)(C)C3(C)C(C)(C)C(C)(C)C3(C)C12C |
| InChI | InChI=1S/C30H54/c1-19(2)21(5,6)28(16)25(19,13)23(9,10)27(15)24(11,12)26(14)20(3,4)22(7,8)29(26,17)30(27,28)18/h1-18H3 |
| InChIKey | IOEGVBDOXOFEKT-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |