C22H25ClN2O4 — CID 91326260
4-[5-(6-chloro-2-methylpyrimidin-4-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91326260) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-[5-(6-chloro-2-methylpyrimidin-4-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(6-chloro-2-methylpyrimidin-4-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91326260 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[5-(6-chloro-2-methylpyrimidin-4-yl)oxy-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2cc(Cl)nc(C)n2)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C22H25ClN2O4/c1-7-13-8-9-14(28-17-11-16(23)24-12(2)25-17)10-15(13)18-19(26)21(3,4)29-22(5,6)20(18)27/h8-11,18H,7H2,1-6H3 |
| InChIKey | NKKWLRMNDKQMJK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|