C10H13N — CID 91326389
4-methylnona-2,4,6,8-tetraen-1-imine (PubChem CID 91326389) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 4-methylnona-2,4,6,8-tetraen-1-imine.
| Compound Name | 4-methylnona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 91326389 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 4-methylnona-2,4,6,8-tetraen-1-imine |
| SMILES | [H]/N=C/C=CC(C)=CC=CC=C |
| InChI | InChI=1S/C10H13N/c1-3-4-5-7-10(2)8-6-9-11/h3-9,11H,1H2,2H3/b5-4?,8-6?,10-7?,11-9+ |
| InChIKey | CPPJMWPSQNCTTR-IWGVEELESA-N |
| XLogP | 2.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|