C25H35ClN2O4 — CID 91326883
[(3R,4S)-10-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-8-pentyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl] carbamate (PubChem CID 91326883) has the molecular formula C25H35ClN2O4 and a molecular weight of 463.02 g/mol. Its IUPAC name is [(3R,4S)-10-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-8-pentyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl] carbamate.
| Compound Name | [(3R,4S)-10-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-8-pentyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl] carbamate |
|---|---|
| PubChem CID | 91326883 |
| Molecular Formula | C25H35ClN2O4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [(3R,4S)-10-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-8-pentyl-3,4-dihydropyrano[2,3-g]quinolin-4-yl] carbamate |
| SMILES | CCCCCc1c(Cl)nc2cc3c(c(C(C)(C)C)c2c1C)OC(C)(C)[C@H](O)[C@H]3OC(N)=O |
| InChI | InChI=1S/C25H35ClN2O4/c1-8-9-10-11-14-13(2)17-16(28-22(14)26)12-15-19(18(17)24(3,4)5)32-25(6,7)21(29)20(15)31-23(27)30/h12,20-21,29H,8-11H2,1-7H3,(H2,27,30)/t20-,21+/m0/s1 |
| InChIKey | VUCLRFLXMFOULW-LEWJYISDSA-N |
| XLogP | 5.90 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|