C26H26N4O4 — CID 91326951
2-[2-[2-(4-butan-2-ylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 91326951) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[2-[2-(4-butan-2-ylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(4-butan-2-ylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91326951 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[2-[2-(4-butan-2-ylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | CCC(C)c1nc2ccccc2c2c1ncn2CCOCCON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H26N4O4/c1-3-17(2)22-23-24(20-10-6-7-11-21(20)28-22)29(16-27-23)12-13-33-14-15-34-30-25(31)18-8-4-5-9-19(18)26(30)32/h4-11,16-17H,3,12-15H2,1-2H3 |
| InChIKey | UXCLBKHEAHZGRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|