C14H18N3O- — CID 91327062
3-(ethylamino)-6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-pyridin-2-one (PubChem CID 91327062) has the molecular formula C14H18N3O- and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-(ethylamino)-6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-pyridin-2-one.
| Compound Name | 3-(ethylamino)-6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 91327062 |
| Molecular Formula | C14H18N3O- |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 3-(ethylamino)-6-methyl-5-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-1H-pyridin-2-one |
| SMILES | C=N/C=C\C(=C/C)c1cc(N[CH-]C)c(=O)[nH]c1C |
| InChI | InChI=1S/C14H18N3O/c1-5-11(7-8-15-4)12-9-13(16-6-2)14(18)17-10(12)3/h5-9,16H,4H2,1-3H3,(H,17,18)/q-1/b8-7-,11-5+ |
| InChIKey | JSFLBVODKLFIRK-LTCQKBRTSA-N |
| XLogP | 2.89 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|