About ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide
ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide (PubChem CID 91327591) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide.
Molecular Properties
| Compound Name | ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide |
| PubChem CID | 91327591 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide |
| SMILES | CC.CC.[H]/N=C/c1cncc(/N=C/N)n1 |
| InChI | InChI=1S/C6H7N5.2C2H6/c7-1-5-2-9-3-6(11-5)10-4-8;2*1-2/h1-4,7H,(H2,8,10,11);2*1-2H3/b7-1+;; |
| InChIKey | JUSUCQMKMGXLFL-DPBOPSLFSA-N |
| XLogP | 2.15 |
| TPSA | 88.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide?
The IUPAC name of ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide (CID 91327591) is ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide.
What is the SMILES notation for ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide?
The canonical SMILES for ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide is CC.CC.[H]/N=C/c1cncc(/N=C/N)n1.
What is the InChIKey of ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide?
The InChIKey is JUSUCQMKMGXLFL-DPBOPSLFSA-N. The full InChI is InChI=1S/C6H7N5.2C2H6/c7-1-5-2-9-3-6(11-5)10-4-8;2*1-2/h1-4,7H,(H2,8,10,11);2*1-2H3/b7-1+;;.
What are the key properties of ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide?
ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide has a molecular weight of 209.30 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-(6-methanimidoylpyrazin-2-yl)methanimidamide is sourced from PubChem (CID 91327591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).