About 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one
5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one (PubChem CID 91328026) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 91328026 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1noc2ncn(N)c(=O)c12 |
| InChI | InChI=1S/C6H6N4O2/c1-3-4-5(12-9-3)8-2-10(7)6(4)11/h2H,7H2,1H3 |
| InChIKey | XEZHQFVKBSLUHD-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one (CID 91328026) is 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one is Cc1noc2ncn(N)c(=O)c12.
What is the InChIKey of 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The InChIKey is XEZHQFVKBSLUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c1-3-4-5(12-9-3)8-2-10(7)6(4)11/h2H,7H2,1H3.
What are the key properties of 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one has a molecular weight of 166.14 g/mol, XLogP of -0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 91328026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).