About ethyl N-(2,2-dicyanoethylidene)carbamate
ethyl N-(2,2-dicyanoethylidene)carbamate (PubChem CID 91328166) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is ethyl N-(2,2-dicyanoethylidene)carbamate.
Molecular Properties
| Compound Name | ethyl N-(2,2-dicyanoethylidene)carbamate |
| PubChem CID | 91328166 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | ethyl N-(2,2-dicyanoethylidene)carbamate |
| SMILES | CCOC(=O)N=CC(C#N)C#N |
| InChI | InChI=1S/C7H7N3O2/c1-2-12-7(11)10-5-6(3-8)4-9/h5-6H,2H2,1H3 |
| InChIKey | MCTJAFJYCCXXCH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(2,2-dicyanoethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2,2-dicyanoethylidene)carbamate?
The IUPAC name of ethyl N-(2,2-dicyanoethylidene)carbamate (CID 91328166) is ethyl N-(2,2-dicyanoethylidene)carbamate.
What is the SMILES notation for ethyl N-(2,2-dicyanoethylidene)carbamate?
The canonical SMILES for ethyl N-(2,2-dicyanoethylidene)carbamate is CCOC(=O)N=CC(C#N)C#N.
What is the InChIKey of ethyl N-(2,2-dicyanoethylidene)carbamate?
The InChIKey is MCTJAFJYCCXXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-2-12-7(11)10-5-6(3-8)4-9/h5-6H,2H2,1H3.
What are the key properties of ethyl N-(2,2-dicyanoethylidene)carbamate?
ethyl N-(2,2-dicyanoethylidene)carbamate has a molecular weight of 165.15 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2,2-dicyanoethylidene)carbamate is sourced from PubChem (CID 91328166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).