C16H16N4O4 — CID 91328366
(4-nitrophenyl) N-ethylcarbamate;1H-pyrrolo[2,3-b]pyridine (PubChem CID 91328366) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is (4-nitrophenyl) N-ethylcarbamate;1H-pyrrolo[2,3-b]pyridine.
| Compound Name | (4-nitrophenyl) N-ethylcarbamate;1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 91328366 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (4-nitrophenyl) N-ethylcarbamate;1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCNC(=O)Oc1ccc([N+](=O)[O-])cc1.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H10N2O4.C7H6N2/c1-2-10-9(12)15-8-5-3-7(4-6-8)11(13)14;1-2-6-3-5-9-7(6)8-4-1/h3-6H,2H2,1H3,(H,10,12);1-5H,(H,8,9) |
| InChIKey | SXKHAVKZEFMZLT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|