C9H8N4O2S — CID 913284
2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione (PubChem CID 913284) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione.
| Compound Name | 2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione |
|---|---|
| PubChem CID | 913284 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione |
| SMILES | Cn1c(=O)c2c(nc3sccn32)n(C)c1=O |
| InChI | InChI=1S/C9H8N4O2S/c1-11-6-5(7(14)12(2)9(11)15)13-3-4-16-8(13)10-6/h3-4H,1-2H3 |
| InChIKey | NUTIVQJAFDPWHQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |