C22H23FN2O2 — CID 91328705
2-[2-[3-(3-fluorophenyl)phenyl]ethyl-(furan-2-ylmethyl)amino]propanamide (PubChem CID 91328705) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[2-[3-(3-fluorophenyl)phenyl]ethyl-(furan-2-ylmethyl)amino]propanamide.
| Compound Name | 2-[2-[3-(3-fluorophenyl)phenyl]ethyl-(furan-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 91328705 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-[2-[3-(3-fluorophenyl)phenyl]ethyl-(furan-2-ylmethyl)amino]propanamide |
| SMILES | CC(C(N)=O)N(CCc1cccc(-c2cccc(F)c2)c1)Cc1ccco1 |
| InChI | InChI=1S/C22H23FN2O2/c1-16(22(24)26)25(15-21-9-4-12-27-21)11-10-17-5-2-6-18(13-17)19-7-3-8-20(23)14-19/h2-9,12-14,16H,10-11,15H2,1H3,(H2,24,26) |
| InChIKey | AINXTPOUVSYJCB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |