About 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane
4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane (PubChem CID 91328789) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane.
Molecular Properties
| Compound Name | 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane |
| PubChem CID | 91328789 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane |
| SMILES | O=C=NCC1(CN=C=O)CCC(N=C=O)CC1 |
| InChI | InChI=1S/C11H13N3O3/c15-7-12-5-11(6-13-8-16)3-1-10(2-4-11)14-9-17/h10H,1-6H2 |
| InChIKey | WPUNQUBRBOLUNB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane?
The IUPAC name of 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane (CID 91328789) is 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane.
What is the SMILES notation for 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane?
The canonical SMILES for 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane is O=C=NCC1(CN=C=O)CCC(N=C=O)CC1.
What is the InChIKey of 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane?
The InChIKey is WPUNQUBRBOLUNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c15-7-12-5-11(6-13-8-16)3-1-10(2-4-11)14-9-17/h10H,1-6H2.
What are the key properties of 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane?
4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane has a molecular weight of 235.24 g/mol, XLogP of 0.92, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanato-1,1-bis(isocyanatomethyl)cyclohexane is sourced from PubChem (CID 91328789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).