C42H80N2O8 — CID 91329171
3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-3-[6-[(3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-2,4-dioxa-9-azaspiro[5.5]undecane (PubChem CID 91329171) has the molecular formula C42H80N2O8 and a molecular weight of 741.11 g/mol. Its IUPAC name is 3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-3-[6-[(3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-2,4-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-3-[6-[(3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-2,4-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 91329171 |
| Molecular Formula | C42H80N2O8 |
| Molecular Weight | 741.11 g/mol |
| Exact Mass | 740.59 |
| IUPAC Name | 3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-3-[6-[(3,8,10-triethyl-9-hydroxy-8,10,11-trimethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methoxy]hexoxymethyl]-2,4-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCC1(COCCCCCCOCC2(CC)OCC3(CO2)CC(C)(CC)N(O)C(C)(CC)C3C)COC2(CC(C)(CC)N(O)C(C)(CC)C2C)OC1 |
| InChI | InChI=1S/C42H80N2O8/c1-13-35(9)25-40(33(7)37(11,15-3)43(35)45)30-49-41(18-6,50-31-40)32-48-24-22-20-19-21-23-47-27-39(17-5)28-51-42(52-29-39)26-36(10,14-2)44(46)38(12,16-4)34(42)8/h33-34,45-46H,13-32H2,1-12H3 |
| InChIKey | NEPXHYVRELKWPE-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.11 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|