C13H19NO6 — CID 91330267
(3R,4R,5S,6R)-2-[amino-(2-hydroxyphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 91330267) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[amino-(2-hydroxyphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[amino-(2-hydroxyphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91330267 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3R,4R,5S,6R)-2-[amino-(2-hydroxyphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NC(c1ccccc1O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19NO6/c14-9(6-3-1-2-4-7(6)16)13-12(19)11(18)10(17)8(5-15)20-13/h1-4,8-13,15-19H,5,14H2/t8-,9?,10-,11+,12-,13?/m1/s1 |
| InChIKey | BGOUVWWIHGEWCK-QDEWEPPJSA-N |
| XLogP | -1.77 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|