C12H17NO2 — CID 91331323
2-benzyl-1,4-oxazepan-2-ol (PubChem CID 91331323) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-benzyl-1,4-oxazepan-2-ol.
| Compound Name | 2-benzyl-1,4-oxazepan-2-ol |
|---|---|
| PubChem CID | 91331323 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-benzyl-1,4-oxazepan-2-ol |
| SMILES | OC1(Cc2ccccc2)CNCCCO1 |
| InChI | InChI=1S/C12H17NO2/c14-12(10-13-7-4-8-15-12)9-11-5-2-1-3-6-11/h1-3,5-6,13-14H,4,7-10H2 |
| InChIKey | BBNAWIWLVVZJAC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |