C22H17N5O4 — CID 91331453
but-3-ynyl (7R)-5-hydroxy-4-(1-isocyanoisoquinolin-4-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylate (PubChem CID 91331453) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is but-3-ynyl (7R)-5-hydroxy-4-(1-isocyanoisoquinolin-4-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylate.
| Compound Name | but-3-ynyl (7R)-5-hydroxy-4-(1-isocyanoisoquinolin-4-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylate |
|---|---|
| PubChem CID | 91331453 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | but-3-ynyl (7R)-5-hydroxy-4-(1-isocyanoisoquinolin-4-yl)-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-ene-8-carboxylate |
| SMILES | [C-]#[N+]c1ncc(-n2c(O)c3n(c2=O)C2C[C@H]3N(C(=O)OCCC#C)C2)c2ccccc12 |
| InChI | InChI=1S/C22H17N5O4/c1-3-4-9-31-22(30)25-12-13-10-16(25)18-20(28)27(21(29)26(13)18)17-11-24-19(23-2)15-8-6-5-7-14(15)17/h1,5-8,11,13,16,28H,4,9-10,12H2/t13?,16-/m1/s1 |
| InChIKey | LUFJAVYHXPEEKT-FQNRMIAFSA-N |
| XLogP | 2.90 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|