C35H41ClN2O5Si — CID 91331534
(2S)-N-[2-chloro-4-(2-trimethylsilylethynyl)phenyl]-2-[[2-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]acetyl]amino]-3-phenylpropanamide (PubChem CID 91331534) has the molecular formula C35H41ClN2O5Si and a molecular weight of 633.26 g/mol. Its IUPAC name is (2S)-N-[2-chloro-4-(2-trimethylsilylethynyl)phenyl]-2-[[2-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[2-chloro-4-(2-trimethylsilylethynyl)phenyl]-2-[[2-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 91331534 |
| Molecular Formula | C35H41ClN2O5Si |
| Molecular Weight | 633.26 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | (2S)-N-[2-chloro-4-(2-trimethylsilylethynyl)phenyl]-2-[[2-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]acetyl]amino]-3-phenylpropanamide |
| SMILES | C[Si](C)(C)C#Cc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)Cc2ccc(OCCO[C@H]3CCCCO3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C35H41ClN2O5Si/c1-44(2,3)22-18-28-14-17-31(30(36)23-28)38-35(40)32(24-26-9-5-4-6-10-26)37-33(39)25-27-12-15-29(16-13-27)41-20-21-43-34-11-7-8-19-42-34/h4-6,9-10,12-17,23,32,34H,7-8,11,19-21,24-25H2,1-3H3,(H,37,39)(H,38,40)/t32-,34-/m0/s1 |
| InChIKey | GGCXHFSJXINBNL-TWJUONSBSA-N |
| XLogP | 6.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.26 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|