C25H22F4O5S — CID 91331895
tert-butyl 2-[2-[4-(benzenesulfonyl)-3-(trifluoromethyl)phenyl]-4-fluorophenoxy]acetate (PubChem CID 91331895) has the molecular formula C25H22F4O5S and a molecular weight of 510.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(benzenesulfonyl)-3-(trifluoromethyl)phenyl]-4-fluorophenoxy]acetate.
| Compound Name | tert-butyl 2-[2-[4-(benzenesulfonyl)-3-(trifluoromethyl)phenyl]-4-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 91331895 |
| Molecular Formula | C25H22F4O5S |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | tert-butyl 2-[2-[4-(benzenesulfonyl)-3-(trifluoromethyl)phenyl]-4-fluorophenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(F)cc1-c1ccc(S(=O)(=O)c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F4O5S/c1-24(2,3)34-23(30)15-33-21-11-10-17(26)14-19(21)16-9-12-22(20(13-16)25(27,28)29)35(31,32)18-7-5-4-6-8-18/h4-14H,15H2,1-3H3 |
| InChIKey | HBFNSBAXXNLXJF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |