C12H12N2O4S — CID 91332092
3-[4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylidene-1H-pyridin-3-yl]propanoic acid (PubChem CID 91332092) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylidene-1H-pyridin-3-yl]propanoic acid.
| Compound Name | 3-[4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylidene-1H-pyridin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 91332092 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylidene-1H-pyridin-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(-n2c(O)ccc2O)cc[nH]c1=S |
| InChI | InChI=1S/C12H12N2O4S/c15-9-2-3-10(16)14(9)8-5-6-13-12(19)7(8)1-4-11(17)18/h2-3,5-6,15-16H,1,4H2,(H,13,19)(H,17,18) |
| InChIKey | LCLYSOGAYJTGNZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|