About 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine
2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine (PubChem CID 91332489) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine |
| PubChem CID | 91332489 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine |
| SMILES | CC(C)C1=CCCCC(C(C)C)=N1 |
| InChI | InChI=1S/C12H21N/c1-9(2)11-7-5-6-8-12(13-11)10(3)4/h7,9-10H,5-6,8H2,1-4H3 |
| InChIKey | UVMSETVFQDNRJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine?
The IUPAC name of 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine (CID 91332489) is 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine.
What is the SMILES notation for 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine?
The canonical SMILES for 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine is CC(C)C1=CCCCC(C(C)C)=N1.
What is the InChIKey of 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine?
The InChIKey is UVMSETVFQDNRJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-9(2)11-7-5-6-8-12(13-11)10(3)4/h7,9-10H,5-6,8H2,1-4H3.
What are the key properties of 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine?
2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine has a molecular weight of 179.31 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-di(propan-2-yl)-4,5-dihydro-3H-azepine is sourced from PubChem (CID 91332489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).