C20H16ClNO5S — CID 91332833
5-(4-acetylphenyl)-N-(2-chloro-5-methylsulfonylphenyl)furan-2-carboxamide (PubChem CID 91332833) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-N-(2-chloro-5-methylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | 5-(4-acetylphenyl)-N-(2-chloro-5-methylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91332833 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 5-(4-acetylphenyl)-N-(2-chloro-5-methylsulfonylphenyl)furan-2-carboxamide |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)Nc3cc(S(C)(=O)=O)ccc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H16ClNO5S/c1-12(23)13-3-5-14(6-4-13)18-9-10-19(27-18)20(24)22-17-11-15(28(2,25)26)7-8-16(17)21/h3-11H,1-2H3,(H,22,24) |
| InChIKey | YJIQAFRDKBNIPX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |