About 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium
2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium (PubChem CID 91332936) has the molecular formula C9H19NO6S
and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium.
Molecular Properties
| Compound Name | 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium |
| PubChem CID | 91332936 |
| Molecular Formula | C9H19NO6S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium |
| SMILES | C=CC[NH3+].CCOCCOC(=O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H12O6S.C3H7N/c1-2-11-3-4-12-6(7)5-13(8,9)10;1-2-3-4/h2-5H2,1H3,(H,8,9,10);2H,1,3-4H2 |
| InChIKey | IEXJYQPMMQCGHB-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium?
The IUPAC name of 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium (CID 91332936) is 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium.
What is the SMILES notation for 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium?
The canonical SMILES for 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium is C=CC[NH3+].CCOCCOC(=O)CS(=O)(=O)[O-].
What is the InChIKey of 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium?
The InChIKey is IEXJYQPMMQCGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6S.C3H7N/c1-2-11-3-4-12-6(7)5-13(8,9)10;1-2-3-4/h2-5H2,1H3,(H,8,9,10);2H,1,3-4H2.
What are the key properties of 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium?
2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium has a molecular weight of 269.32 g/mol, XLogP of -1.47, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethoxy)-2-oxoethanesulfonate;prop-2-enylazanium is sourced from PubChem (CID 91332936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).