C42H77NO7 — CID 91333113
[(2R)-3-[(2S)-2-amino-3-hydroxypropanoyl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate (PubChem CID 91333113) has the molecular formula C42H77NO7 and a molecular weight of 708.08 g/mol. Its IUPAC name is [(2R)-3-[(2S)-2-amino-3-hydroxypropanoyl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate.
| Compound Name | [(2R)-3-[(2S)-2-amino-3-hydroxypropanoyl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 91333113 |
| Molecular Formula | C42H77NO7 |
| Molecular Weight | 708.08 g/mol |
| Exact Mass | 707.57 |
| IUPAC Name | [(2R)-3-[(2S)-2-amino-3-hydroxypropanoyl]oxy-2-octadec-9-enoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](COC(=O)[C@@H](N)CO)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C42H77NO7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(45)48-36-38(37-49-42(47)39(43)35-44)50-41(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,38-39,44H,3-16,21-37,43H2,1-2H3/t38-,39+/m1/s1 |
| InChIKey | IUZXRZGFAQFXNB-RGULYWFUSA-N |
| XLogP | 10.38 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.08 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|