About 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine
1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine (PubChem CID 91333279) has the molecular formula C22H36N2O3
and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine |
| PubChem CID | 91333279 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine |
| SMILES | COc1cc(OCCCN2CCN(C)CC2)cc(C2CCCCC2)c1OC |
| InChI | InChI=1S/C22H36N2O3/c1-23-11-13-24(14-12-23)10-7-15-27-19-16-20(18-8-5-4-6-9-18)22(26-3)21(17-19)25-2/h16-18H,4-15H2,1-3H3 |
| InChIKey | BWAARUZHAXBKOA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine?
The IUPAC name of 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine (CID 91333279) is 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine.
What is the SMILES notation for 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine?
The canonical SMILES for 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine is COc1cc(OCCCN2CCN(C)CC2)cc(C2CCCCC2)c1OC.
What is the InChIKey of 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine?
The InChIKey is BWAARUZHAXBKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O3/c1-23-11-13-24(14-12-23)10-7-15-27-19-16-20(18-8-5-4-6-9-18)22(26-3)21(17-19)25-2/h16-18H,4-15H2,1-3H3.
What are the key properties of 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine?
1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine has a molecular weight of 376.54 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3-cyclohexyl-4,5-dimethoxyphenoxy)propyl]-4-methylpiperazine is sourced from PubChem (CID 91333279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).