C9H5FO6 — CID 91333579
1-fluoro-6-methyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 91333579) has the molecular formula C9H5FO6 and a molecular weight of 228.13 g/mol. Its IUPAC name is 1-fluoro-6-methyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1-fluoro-6-methyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 91333579 |
| Molecular Formula | C9H5FO6 |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-fluoro-6-methyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | CC12C(=O)OC(=O)C1C1(F)C(=O)OC(=O)C21 |
| InChI | InChI=1S/C9H5FO6/c1-8-2(4(11)15-6(8)13)9(10)3(8)5(12)16-7(9)14/h2-3H,1H3 |
| InChIKey | BBQQSNCGVDMUJK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|