C10H18N2O6 — CID 91333838
2-[2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide (PubChem CID 91333838) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide.
| Compound Name | 2-[2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 91333838 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide |
| SMILES | CC(C(N)=O)N1CC(C(O)(O)C(C)(O)O)CC1=O |
| InChI | InChI=1S/C10H18N2O6/c1-5(8(11)14)12-4-6(3-7(12)13)10(17,18)9(2,15)16/h5-6,15-18H,3-4H2,1-2H3,(H2,11,14) |
| InChIKey | JZTQJQLKWAPCKG-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|