C14H31NO2 — CID 91333919
(3R,5R)-3-(3-hydroxypropylamino)-2,3,5,6-tetramethylheptan-4-ol (PubChem CID 91333919) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is (3R,5R)-3-(3-hydroxypropylamino)-2,3,5,6-tetramethylheptan-4-ol.
| Compound Name | (3R,5R)-3-(3-hydroxypropylamino)-2,3,5,6-tetramethylheptan-4-ol |
|---|---|
| PubChem CID | 91333919 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | (3R,5R)-3-(3-hydroxypropylamino)-2,3,5,6-tetramethylheptan-4-ol |
| SMILES | CC(C)[C@@H](C)C(O)[C@](C)(NCCCO)C(C)C |
| InChI | InChI=1S/C14H31NO2/c1-10(2)12(5)13(17)14(6,11(3)4)15-8-7-9-16/h10-13,15-17H,7-9H2,1-6H3/t12-,13?,14-/m1/s1 |
| InChIKey | QUSOVVDGKJIIPI-WYAMFQBQSA-N |
| XLogP | 2.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|