About [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate
[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate (PubChem CID 91334035) has the molecular formula C12H8F3NO2S
and a molecular weight of 287.26 g/mol. Its IUPAC name is [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate.
Molecular Properties
| Compound Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate |
| PubChem CID | 91334035 |
| Molecular Formula | C12H8F3NO2S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate |
| SMILES | O=COCc1csc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H8F3NO2S/c13-12(14,15)9-3-1-8(2-4-9)11-16-10(6-19-11)5-18-7-17/h1-4,6-7H,5H2 |
| InChIKey | JXUNSYXGNFKXEP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate?
The IUPAC name of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate (CID 91334035) is [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate.
What is the SMILES notation for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate?
The canonical SMILES for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate is O=COCc1csc(-c2ccc(C(F)(F)F)cc2)n1.
What is the InChIKey of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate?
The InChIKey is JXUNSYXGNFKXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO2S/c13-12(14,15)9-3-1-8(2-4-9)11-16-10(6-19-11)5-18-7-17/h1-4,6-7H,5H2.
What are the key properties of [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate?
[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate has a molecular weight of 287.26 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl formate is sourced from PubChem (CID 91334035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).