About 3-(1,2,4-triazol-1-yl)butanal
3-(1,2,4-triazol-1-yl)butanal (PubChem CID 91334158) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)butanal.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-1-yl)butanal |
| PubChem CID | 91334158 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)butanal |
| SMILES | CC(CC=O)n1cncn1 |
| InChI | InChI=1S/C6H9N3O/c1-6(2-3-10)9-5-7-4-8-9/h3-6H,2H2,1H3 |
| InChIKey | SJXDGJVAEGYMAX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,4-triazol-1-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-1-yl)butanal?
The IUPAC name of 3-(1,2,4-triazol-1-yl)butanal (CID 91334158) is 3-(1,2,4-triazol-1-yl)butanal.
What is the SMILES notation for 3-(1,2,4-triazol-1-yl)butanal?
The canonical SMILES for 3-(1,2,4-triazol-1-yl)butanal is CC(CC=O)n1cncn1.
What is the InChIKey of 3-(1,2,4-triazol-1-yl)butanal?
The InChIKey is SJXDGJVAEGYMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-6(2-3-10)9-5-7-4-8-9/h3-6H,2H2,1H3.
What are the key properties of 3-(1,2,4-triazol-1-yl)butanal?
3-(1,2,4-triazol-1-yl)butanal has a molecular weight of 139.16 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-1-yl)butanal is sourced from PubChem (CID 91334158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).