C18H17F2N3O2S — CID 91334167
2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethynyl]benzaldehyde (PubChem CID 91334167) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethynyl]benzaldehyde.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethynyl]benzaldehyde |
|---|---|
| PubChem CID | 91334167 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-3,4-difluoro-5-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethynyl]benzaldehyde |
| SMILES | Cc1nnc(C#Cc2cc(C=O)c(N3CC(C)OC(C)C3)c(F)c2F)s1 |
| InChI | InChI=1S/C18H17F2N3O2S/c1-10-7-23(8-11(2)25-10)18-14(9-24)6-13(16(19)17(18)20)4-5-15-22-21-12(3)26-15/h6,9-11H,7-8H2,1-3H3 |
| InChIKey | AUFKVJZHFXKOPJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|