About propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate
propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate (PubChem CID 91335155) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate |
| PubChem CID | 91335155 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate |
| SMILES | CCCOC(=O)N1CC(C2=CCCC=C2)C(N(C)C)C1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-10-20-16(19)18-11-14(15(12-18)17(2)3)13-8-6-5-7-9-13/h6,8-9,14-15H,4-5,7,10-12H2,1-3H3 |
| InChIKey | JKQXGDZJBUCIJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate?
The IUPAC name of propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate (CID 91335155) is propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate.
What is the SMILES notation for propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate?
The canonical SMILES for propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate is CCCOC(=O)N1CC(C2=CCCC=C2)C(N(C)C)C1.
What is the InChIKey of propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate?
The InChIKey is JKQXGDZJBUCIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-4-10-20-16(19)18-11-14(15(12-18)17(2)3)13-8-6-5-7-9-13/h6,8-9,14-15H,4-5,7,10-12H2,1-3H3.
What are the key properties of propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate?
propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate has a molecular weight of 278.40 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-cyclohexa-1,5-dien-1-yl-4-(dimethylamino)pyrrolidine-1-carboxylate is sourced from PubChem (CID 91335155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).