C13H21N3 — CID 91335327
ethane;N,1,7-trimethyl-3,4-dihydro-1,8-naphthyridin-2-imine (PubChem CID 91335327) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;N,1,7-trimethyl-3,4-dihydro-1,8-naphthyridin-2-imine.
| Compound Name | ethane;N,1,7-trimethyl-3,4-dihydro-1,8-naphthyridin-2-imine |
|---|---|
| PubChem CID | 91335327 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | ethane;N,1,7-trimethyl-3,4-dihydro-1,8-naphthyridin-2-imine |
| SMILES | C/N=C1\CCc2ccc(C)nc2N1C.CC |
| InChI | InChI=1S/C11H15N3.C2H6/c1-8-4-5-9-6-7-10(12-2)14(3)11(9)13-8;1-2/h4-5H,6-7H2,1-3H3;1-2H3/b12-10+; |
| InChIKey | WTIPTTQIMIKROW-VHPXAQPISA-N |
| XLogP | 2.83 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|